C17H18BrNO5S — CID 56578687
methyl 4-[(5-bromo-2-methoxyphenyl)methyl-methylsulfonylamino]benzoate (PubChem CID 56578687) has the molecular formula C17H18BrNO5S and a molecular weight of 428.30 g/mol. Its IUPAC name is methyl 4-[(5-bromo-2-methoxyphenyl)methyl-methylsulfonylamino]benzoate.
| Compound Name | methyl 4-[(5-bromo-2-methoxyphenyl)methyl-methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 56578687 |
| Molecular Formula | C17H18BrNO5S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | methyl 4-[(5-bromo-2-methoxyphenyl)methyl-methylsulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(N(Cc2cc(Br)ccc2OC)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18BrNO5S/c1-23-16-9-6-14(18)10-13(16)11-19(25(3,21)22)15-7-4-12(5-8-15)17(20)24-2/h4-10H,11H2,1-3H3 |
| InChIKey | MIUVSPIUHVQICX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |