C17H25NO5S — CID 19615891
methyl 3-[[cyclohexyl(methylsulfonyl)amino]methyl]-4-methoxybenzoate (PubChem CID 19615891) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is methyl 3-[[cyclohexyl(methylsulfonyl)amino]methyl]-4-methoxybenzoate.
| Compound Name | methyl 3-[[cyclohexyl(methylsulfonyl)amino]methyl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 19615891 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl 3-[[cyclohexyl(methylsulfonyl)amino]methyl]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(CN(C2CCCCC2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H25NO5S/c1-22-16-10-9-13(17(19)23-2)11-14(16)12-18(24(3,20)21)15-7-5-4-6-8-15/h9-11,15H,4-8,12H2,1-3H3 |
| InChIKey | WNXLDCLPSSUUOC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |