C16H24NO3+ — CID 7175810
cyclohexyl-[(2-methoxy-5-methoxycarbonylphenyl)methyl]azanium (PubChem CID 7175810) has the molecular formula C16H24NO3+ and a molecular weight of 278.37 g/mol. Its IUPAC name is cyclohexyl-[(2-methoxy-5-methoxycarbonylphenyl)methyl]azanium.
| Compound Name | cyclohexyl-[(2-methoxy-5-methoxycarbonylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7175810 |
| Molecular Formula | C16H24NO3+ |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | cyclohexyl-[(2-methoxy-5-methoxycarbonylphenyl)methyl]azanium |
| SMILES | COC(=O)c1ccc(OC)c(C[NH2+]C2CCCCC2)c1 |
| InChI | InChI=1S/C16H23NO3/c1-19-15-9-8-12(16(18)20-2)10-13(15)11-17-14-6-4-3-5-7-14/h8-10,14,17H,3-7,11H2,1-2H3/p+1 |
| InChIKey | RASKANXPDRQCSG-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 52.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |