C19H27N2O5+ — CID 2368083
[2-[3,5-bis(methoxycarbonyl)anilino]-2-oxoethyl]-cycloheptylazanium (PubChem CID 2368083) has the molecular formula C19H27N2O5+ and a molecular weight of 363.43 g/mol. Its IUPAC name is [2-[3,5-bis(methoxycarbonyl)anilino]-2-oxoethyl]-cycloheptylazanium.
| Compound Name | [2-[3,5-bis(methoxycarbonyl)anilino]-2-oxoethyl]-cycloheptylazanium |
|---|---|
| PubChem CID | 2368083 |
| Molecular Formula | C19H27N2O5+ |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | [2-[3,5-bis(methoxycarbonyl)anilino]-2-oxoethyl]-cycloheptylazanium |
| SMILES | COC(=O)c1cc(NC(=O)C[NH2+]C2CCCCCC2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H26N2O5/c1-25-18(23)13-9-14(19(24)26-2)11-16(10-13)21-17(22)12-20-15-7-5-3-4-6-8-15/h9-11,15,20H,3-8,12H2,1-2H3,(H,21,22)/p+1 |
| InChIKey | YATJVBYBVKIPKW-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |