C18H23NO5 — CID 46798654
dimethyl 5-[(2-cyclohexylacetyl)amino]benzene-1,3-dicarboxylate (PubChem CID 46798654) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is dimethyl 5-[(2-cyclohexylacetyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(2-cyclohexylacetyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 46798654 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | dimethyl 5-[(2-cyclohexylacetyl)amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CC2CCCCC2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H23NO5/c1-23-17(21)13-9-14(18(22)24-2)11-15(10-13)19-16(20)8-12-6-4-3-5-7-12/h9-12H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | VPDQQFOHAIVFOK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |