C24H31N3O7 — CID 26183339
dimethyl 5-[[2-[(2R,4aS,8aS)-1-(2-methylpropanoyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 26183339) has the molecular formula C24H31N3O7 and a molecular weight of 473.53 g/mol. Its IUPAC name is dimethyl 5-[[2-[(2R,4aS,8aS)-1-(2-methylpropanoyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[(2R,4aS,8aS)-1-(2-methylpropanoyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 26183339 |
| Molecular Formula | C24H31N3O7 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | dimethyl 5-[[2-[(2R,4aS,8aS)-1-(2-methylpropanoyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C[C@@H]2C(=O)N[C@H]3CCCC[C@@H]3N2C(=O)C(C)C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C24H31N3O7/c1-13(2)22(30)27-18-8-6-5-7-17(18)26-21(29)19(27)12-20(28)25-16-10-14(23(31)33-3)9-15(11-16)24(32)34-4/h9-11,13,17-19H,5-8,12H2,1-4H3,(H,25,28)(H,26,29)/t17-,18-,19+/m0/s1 |
| InChIKey | YTTKBVQXEQZCFF-GBESFXJTSA-N |
| XLogP | 1.88 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |