C20H28N4O4 — CID 7368982
(2R,4aR,8aS)-N-ethyl-2-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide (PubChem CID 7368982) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2R,4aR,8aS)-N-ethyl-2-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide.
| Compound Name | (2R,4aR,8aS)-N-ethyl-2-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 7368982 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (2R,4aR,8aS)-N-ethyl-2-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
| SMILES | CCNC(=O)N1[C@H](CC(=O)Nc2cccc(OC)c2)C(=O)N[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C20H28N4O4/c1-3-21-20(27)24-16-10-5-4-9-15(16)23-19(26)17(24)12-18(25)22-13-7-6-8-14(11-13)28-2/h6-8,11,15-17H,3-5,9-10,12H2,1-2H3,(H,21,27)(H,22,25)(H,23,26)/t15-,16+,17-/m1/s1 |
| InChIKey | HYXVAKFIZAAKMH-IXDOHACOSA-N |
| XLogP | 1.86 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |