C24H26N4O6 — CID 124832615
2-[(2R,4aR,8aR)-1-(2-methoxybenzoyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 124832615) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is 2-[(2R,4aR,8aR)-1-(2-methoxybenzoyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(2R,4aR,8aR)-1-(2-methoxybenzoyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 124832615 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-[(2R,4aR,8aR)-1-(2-methoxybenzoyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1ccccc1C(=O)N1[C@H](CC(=O)Nc2cccc([N+](=O)[O-])c2)C(=O)N[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C24H26N4O6/c1-34-21-12-5-2-9-17(21)24(31)27-19-11-4-3-10-18(19)26-23(30)20(27)14-22(29)25-15-7-6-8-16(13-15)28(32)33/h2,5-9,12-13,18-20H,3-4,10-11,14H2,1H3,(H,25,29)(H,26,30)/t18-,19-,20-/m1/s1 |
| InChIKey | GUPAPCHIOGZSRE-VAMGGRTRSA-N |
| XLogP | 2.88 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|