C19H25N3O4S — CID 6559547
methyl 2-[(2R,4aS,8aR)-1-[(3-methoxyphenyl)carbamothioyl]-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]acetate (PubChem CID 6559547) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is methyl 2-[(2R,4aS,8aR)-1-[(3-methoxyphenyl)carbamothioyl]-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4aS,8aR)-1-[(3-methoxyphenyl)carbamothioyl]-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]acetate |
|---|---|
| PubChem CID | 6559547 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | methyl 2-[(2R,4aS,8aR)-1-[(3-methoxyphenyl)carbamothioyl]-3-oxo-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C(=O)N[C@H]2CCCC[C@H]2N1C(=S)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C19H25N3O4S/c1-25-13-7-5-6-12(10-13)20-19(27)22-15-9-4-3-8-14(15)21-18(24)16(22)11-17(23)26-2/h5-7,10,14-16H,3-4,8-9,11H2,1-2H3,(H,20,27)(H,21,24)/t14-,15+,16+/m0/s1 |
| InChIKey | QJGQSEHEHZFGMX-ARFHVFGLSA-N |
| XLogP | 2.07 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|