C18H16N4O5 — CID 1288963
2-[(2R)-1-acetyl-3-oxo-2,4-dihydroquinoxalin-2-yl]-N-(3-nitrophenyl)acetamide (PubChem CID 1288963) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is 2-[(2R)-1-acetyl-3-oxo-2,4-dihydroquinoxalin-2-yl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[(2R)-1-acetyl-3-oxo-2,4-dihydroquinoxalin-2-yl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1288963 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-[(2R)-1-acetyl-3-oxo-2,4-dihydroquinoxalin-2-yl]-N-(3-nitrophenyl)acetamide |
| SMILES | CC(=O)N1c2ccccc2NC(=O)[C@H]1CC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N4O5/c1-11(23)21-15-8-3-2-7-14(15)20-18(25)16(21)10-17(24)19-12-5-4-6-13(9-12)22(26)27/h2-9,16H,10H2,1H3,(H,19,24)(H,20,25)/t16-/m1/s1 |
| InChIKey | ZNRUGYGFNQGSIT-MRXNPFEDSA-N |
| XLogP | 2.30 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|