C24H20N4O6 — CID 34307419
N-(4-methoxyphenyl)-2-[(2S)-1-(3-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide (PubChem CID 34307419) has the molecular formula C24H20N4O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(2S)-1-(3-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(2S)-1-(3-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 34307419 |
| Molecular Formula | C24H20N4O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(2S)-1-(3-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
| SMILES | COc1ccc(NC(=O)C[C@H]2C(=O)Nc3ccccc3N2C(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H20N4O6/c1-34-18-11-9-16(10-12-18)25-22(29)14-21-23(30)26-19-7-2-3-8-20(19)27(21)24(31)15-5-4-6-17(13-15)28(32)33/h2-13,21H,14H2,1H3,(H,25,29)(H,26,30)/t21-/m0/s1 |
| InChIKey | QXLUTCWESDDCCI-NRFANRHFSA-N |
| XLogP | 3.60 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|