C26H22N4O7 — CID 34316380
ethyl 4-[[2-[(2R)-1-(3-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetyl]amino]benzoate (PubChem CID 34316380) has the molecular formula C26H22N4O7 and a molecular weight of 502.48 g/mol. Its IUPAC name is ethyl 4-[[2-[(2R)-1-(3-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2R)-1-(3-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 34316380 |
| Molecular Formula | C26H22N4O7 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | ethyl 4-[[2-[(2R)-1-(3-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[C@@H]2C(=O)Nc3ccccc3N2C(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H22N4O7/c1-2-37-26(34)16-10-12-18(13-11-16)27-23(31)15-22-24(32)28-20-8-3-4-9-21(20)29(22)25(33)17-6-5-7-19(14-17)30(35)36/h3-14,22H,2,15H2,1H3,(H,27,31)(H,28,32)/t22-/m1/s1 |
| InChIKey | WMMUZSWOLUJJSM-JOCHJYFZSA-N |
| XLogP | 3.77 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|