C23H17BrN4O5 — CID 34307056
N-(4-bromophenyl)-2-[(2R)-1-(4-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide (PubChem CID 34307056) has the molecular formula C23H17BrN4O5 and a molecular weight of 509.32 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(2R)-1-(4-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(2R)-1-(4-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 34307056 |
| Molecular Formula | C23H17BrN4O5 |
| Molecular Weight | 509.32 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | N-(4-bromophenyl)-2-[(2R)-1-(4-nitrobenzoyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
| SMILES | O=C(C[C@@H]1C(=O)Nc2ccccc2N1C(=O)c1ccc([N+](=O)[O-])cc1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H17BrN4O5/c24-15-7-9-16(10-8-15)25-21(29)13-20-22(30)26-18-3-1-2-4-19(18)27(20)23(31)14-5-11-17(12-6-14)28(32)33/h1-12,20H,13H2,(H,25,29)(H,26,30)/t20-/m1/s1 |
| InChIKey | GRAQXJNFMHGUBU-HXUWFJFHSA-N |
| XLogP | 4.35 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|