C26H25N5O6 — CID 26888149
N-(2-methoxy-4-nitrophenyl)-2-[(2R)-1-[2-(4-methylanilino)-2-oxoethyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide (PubChem CID 26888149) has the molecular formula C26H25N5O6 and a molecular weight of 503.52 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-2-[(2R)-1-[2-(4-methylanilino)-2-oxoethyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-2-[(2R)-1-[2-(4-methylanilino)-2-oxoethyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 26888149 |
| Molecular Formula | C26H25N5O6 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-2-[(2R)-1-[2-(4-methylanilino)-2-oxoethyl]-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C[C@@H]1C(=O)Nc2ccccc2N1CC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C26H25N5O6/c1-16-7-9-17(10-8-16)27-25(33)15-30-21-6-4-3-5-19(21)29-26(34)22(30)14-24(32)28-20-12-11-18(31(35)36)13-23(20)37-2/h3-13,22H,14-15H2,1-2H3,(H,27,33)(H,28,32)(H,29,34)/t22-/m1/s1 |
| InChIKey | ZQOJHQDRYYOQHL-JOCHJYFZSA-N |
| XLogP | 3.71 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|