C23H20N4O6S — CID 21204405
2-[1-(benzenesulfonyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]-N-(4-methyl-2-nitrophenyl)acetamide (PubChem CID 21204405) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]-N-(4-methyl-2-nitrophenyl)acetamide.
| Compound Name | 2-[1-(benzenesulfonyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]-N-(4-methyl-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 21204405 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-[1-(benzenesulfonyl)-3-oxo-2,4-dihydroquinoxalin-2-yl]-N-(4-methyl-2-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2C(=O)Nc3ccccc3N2S(=O)(=O)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N4O6S/c1-15-11-12-18(20(13-15)27(30)31)24-22(28)14-21-23(29)25-17-9-5-6-10-19(17)26(21)34(32,33)16-7-3-2-4-8-16/h2-13,21H,14H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | CVRBJNYYSJBUNZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|