C23H20ClN3O4S — CID 22064876
N-benzyl-2-[1-(3-chlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide (PubChem CID 22064876) has the molecular formula C23H20ClN3O4S and a molecular weight of 469.95 g/mol. Its IUPAC name is N-benzyl-2-[1-(3-chlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide.
| Compound Name | N-benzyl-2-[1-(3-chlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 22064876 |
| Molecular Formula | C23H20ClN3O4S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-benzyl-2-[1-(3-chlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
| SMILES | O=C(CC1C(=O)Nc2ccccc2N1S(=O)(=O)c1cccc(Cl)c1)NCc1ccccc1 |
| InChI | InChI=1S/C23H20ClN3O4S/c24-17-9-6-10-18(13-17)32(30,31)27-20-12-5-4-11-19(20)26-23(29)21(27)14-22(28)25-15-16-7-2-1-3-8-16/h1-13,21H,14-15H2,(H,25,28)(H,26,29) |
| InChIKey | KZDGQWVGVPKTEV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |