C24H22Cl2N4O4S — CID 11284009
N-[2-(4-aminophenyl)ethyl]-2-[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide (PubChem CID 11284009) has the molecular formula C24H22Cl2N4O4S and a molecular weight of 533.44 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 11284009 |
| Molecular Formula | C24H22Cl2N4O4S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]acetamide |
| SMILES | Nc1ccc(CCNC(=O)C[C@@H]2C(=O)Nc3ccccc3N2S(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H22Cl2N4O4S/c25-18-10-9-17(13-19(18)26)35(33,34)30-21-4-2-1-3-20(21)29-24(32)22(30)14-23(31)28-12-11-15-5-7-16(27)8-6-15/h1-10,13,22H,11-12,14,27H2,(H,28,31)(H,29,32)/t22-/m1/s1 |
| InChIKey | OBEBQGRJOSOHQM-JOCHJYFZSA-N |
| XLogP | 3.84 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|