C28H29Cl2N5O4S — CID 11753712
N-[[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]methyl]-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanamide (PubChem CID 11753712) has the molecular formula C28H29Cl2N5O4S and a molecular weight of 602.54 g/mol. Its IUPAC name is N-[[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]methyl]-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanamide.
| Compound Name | N-[[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]methyl]-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanamide |
|---|---|
| PubChem CID | 11753712 |
| Molecular Formula | C28H29Cl2N5O4S |
| Molecular Weight | 602.54 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | N-[[(2R)-1-(3,4-dichlorophenyl)sulfonyl-3-oxo-2,4-dihydroquinoxalin-2-yl]methyl]-5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanamide |
| SMILES | O=C(CCCCc1ccc2c(n1)NCCC2)NC[C@@H]1C(=O)Nc2ccccc2N1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H29Cl2N5O4S/c29-21-14-13-20(16-22(21)30)40(38,39)35-24-9-3-2-8-23(24)34-28(37)25(35)17-32-26(36)10-4-1-7-19-12-11-18-6-5-15-31-27(18)33-19/h2-3,8-9,11-14,16,25H,1,4-7,10,15,17H2,(H,31,33)(H,32,36)(H,34,37)/t25-/m1/s1 |
| InChIKey | RHZWBTDFINTRFB-RUZDIDTESA-N |
| XLogP | 4.79 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|