C19H15ClN6O5 — CID 135994226
2-[2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 135994226) has the molecular formula C19H15ClN6O5 and a molecular weight of 442.82 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 135994226 |
| Molecular Formula | C19H15ClN6O5 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CC1C(=O)Nc2nc(-c3ccc(Cl)cc3)nn21 |
| InChI | InChI=1S/C19H15ClN6O5/c1-31-15-8-12(26(29)30)6-7-13(15)21-16(27)9-14-18(28)23-19-22-17(24-25(14)19)10-2-4-11(20)5-3-10/h2-8,14H,9H2,1H3,(H,21,27)(H,22,23,24,28) |
| InChIKey | OVINSEHYHYAFTD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|