C18H12Cl3N5O2 — CID 135902225
2-[(6S)-2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 135902225) has the molecular formula C18H12Cl3N5O2 and a molecular weight of 436.69 g/mol. Its IUPAC name is 2-[(6S)-2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(6S)-2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 135902225 |
| Molecular Formula | C18H12Cl3N5O2 |
| Molecular Weight | 436.69 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 2-[(6S)-2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(C[C@H]1C(=O)Nc2nc(-c3ccc(Cl)cc3)nn21)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H12Cl3N5O2/c19-10-3-1-9(2-4-10)16-23-18-24-17(28)14(26(18)25-16)8-15(27)22-11-5-6-12(20)13(21)7-11/h1-7,14H,8H2,(H,22,27)(H,23,24,25,28)/t14-/m0/s1 |
| InChIKey | AOANSAGSLMWLIR-AWEZNQCLSA-N |
| XLogP | 4.43 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |