C20H18ClN5O2 — CID 135878642
2-[(6R)-2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 135878642) has the molecular formula C20H18ClN5O2 and a molecular weight of 395.85 g/mol. Its IUPAC name is 2-[(6R)-2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(6R)-2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 135878642 |
| Molecular Formula | C20H18ClN5O2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[(6R)-2-(4-chlorophenyl)-5-oxo-4,6-dihydroimidazo[1,2-b][1,2,4]triazol-6-yl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[C@@H]2C(=O)Nc3nc(-c4ccc(Cl)cc4)nn32)cc1C |
| InChI | InChI=1S/C20H18ClN5O2/c1-11-3-8-15(9-12(11)2)22-17(27)10-16-19(28)24-20-23-18(25-26(16)20)13-4-6-14(21)7-5-13/h3-9,16H,10H2,1-2H3,(H,22,27)(H,23,24,25,28)/t16-/m1/s1 |
| InChIKey | ZECYZUUYBDZKMX-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |