C15H24NO3+ — CID 6941897
cyclopentyl-[(2,3,4-trimethoxyphenyl)methyl]azanium (PubChem CID 6941897) has the molecular formula C15H24NO3+ and a molecular weight of 266.36 g/mol. Its IUPAC name is cyclopentyl-[(2,3,4-trimethoxyphenyl)methyl]azanium.
| Compound Name | cyclopentyl-[(2,3,4-trimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 6941897 |
| Molecular Formula | C15H24NO3+ |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | cyclopentyl-[(2,3,4-trimethoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]C2CCCC2)c(OC)c1OC |
| InChI | InChI=1S/C15H23NO3/c1-17-13-9-8-11(14(18-2)15(13)19-3)10-16-12-6-4-5-7-12/h8-9,12,16H,4-7,10H2,1-3H3/p+1 |
| InChIKey | WQFRXDPSYHVMLY-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |