C19H26NO+ — CID 6944223
(4-methoxynaphthalen-1-yl)methyl-[(1R,2S)-2-methylcyclohexyl]azanium (PubChem CID 6944223) has the molecular formula C19H26NO+ and a molecular weight of 284.42 g/mol. Its IUPAC name is (4-methoxynaphthalen-1-yl)methyl-[(1R,2S)-2-methylcyclohexyl]azanium.
| Compound Name | (4-methoxynaphthalen-1-yl)methyl-[(1R,2S)-2-methylcyclohexyl]azanium |
|---|---|
| PubChem CID | 6944223 |
| Molecular Formula | C19H26NO+ |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (4-methoxynaphthalen-1-yl)methyl-[(1R,2S)-2-methylcyclohexyl]azanium |
| SMILES | COc1ccc(C[NH2+][C@@H]2CCCC[C@@H]2C)c2ccccc12 |
| InChI | InChI=1S/C19H25NO/c1-14-7-3-6-10-18(14)20-13-15-11-12-19(21-2)17-9-5-4-8-16(15)17/h4-5,8-9,11-12,14,18,20H,3,6-7,10,13H2,1-2H3/p+1/t14-,18+/m0/s1 |
| InChIKey | GMTJIBVWBOAREF-KBXCAEBGSA-O |
| XLogP | 3.49 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |