C18H29INO2+ — CID 2236098
(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methyl-[(1R,2R)-2-methylcyclohexyl]azanium (PubChem CID 2236098) has the molecular formula C18H29INO2+ and a molecular weight of 418.34 g/mol. Its IUPAC name is (3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methyl-[(1R,2R)-2-methylcyclohexyl]azanium.
| Compound Name | (3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methyl-[(1R,2R)-2-methylcyclohexyl]azanium |
|---|---|
| PubChem CID | 2236098 |
| Molecular Formula | C18H29INO2+ |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methyl-[(1R,2R)-2-methylcyclohexyl]azanium |
| SMILES | COc1cc(C[NH2+][C@@H]2CCCC[C@H]2C)cc(I)c1OC(C)C |
| InChI | InChI=1S/C18H28INO2/c1-12(2)22-18-15(19)9-14(10-17(18)21-4)11-20-16-8-6-5-7-13(16)3/h9-10,12-13,16,20H,5-8,11H2,1-4H3/p+1/t13-,16-/m1/s1 |
| InChIKey | XUEKKNSCRCBAOL-CZUORRHYSA-O |
| XLogP | 3.73 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|