C12H17IO3 — CID 45371618
(4-butan-2-yloxy-3-iodo-5-methoxyphenyl)methanol (PubChem CID 45371618) has the molecular formula C12H17IO3 and a molecular weight of 336.17 g/mol. Its IUPAC name is (4-butan-2-yloxy-3-iodo-5-methoxyphenyl)methanol.
| Compound Name | (4-butan-2-yloxy-3-iodo-5-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 45371618 |
| Molecular Formula | C12H17IO3 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | (4-butan-2-yloxy-3-iodo-5-methoxyphenyl)methanol |
| SMILES | CCC(C)Oc1c(I)cc(CO)cc1OC |
| InChI | InChI=1S/C12H17IO3/c1-4-8(2)16-12-10(13)5-9(7-14)6-11(12)15-3/h5-6,8,14H,4,7H2,1-3H3 |
| InChIKey | NRNVEOXJRLVPHP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|