C14H23NO3 — CID 54930550
2-(4-butan-2-yloxy-3,5-dimethoxyphenyl)ethanamine (PubChem CID 54930550) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-(4-butan-2-yloxy-3,5-dimethoxyphenyl)ethanamine.
| Compound Name | 2-(4-butan-2-yloxy-3,5-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 54930550 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-(4-butan-2-yloxy-3,5-dimethoxyphenyl)ethanamine |
| SMILES | CCC(C)Oc1c(OC)cc(CCN)cc1OC |
| InChI | InChI=1S/C14H23NO3/c1-5-10(2)18-14-12(16-3)8-11(6-7-15)9-13(14)17-4/h8-10H,5-7,15H2,1-4H3 |
| InChIKey | KBNIGQYPTGSZSI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |