C10H12ClF2NO2 — CID 60906197
2-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]ethanamine (PubChem CID 60906197) has the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. Its IUPAC name is 2-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]ethanamine.
| Compound Name | 2-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 60906197 |
| Molecular Formula | C10H12ClF2NO2 |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]ethanamine |
| SMILES | COc1cc(CCN)cc(Cl)c1OC(F)F |
| InChI | InChI=1S/C10H12ClF2NO2/c1-15-8-5-6(2-3-14)4-7(11)9(8)16-10(12)13/h4-5,10H,2-3,14H2,1H3 |
| InChIKey | DQXGRUDBHZKJRC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |