C8H7Cl2F2NO — CID 121228247
[3,5-dichloro-4-(difluoromethoxy)phenyl]methanamine (PubChem CID 121228247) has the molecular formula C8H7Cl2F2NO and a molecular weight of 242.05 g/mol. Its IUPAC name is [3,5-dichloro-4-(difluoromethoxy)phenyl]methanamine.
| Compound Name | [3,5-dichloro-4-(difluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 121228247 |
| Molecular Formula | C8H7Cl2F2NO |
| Molecular Weight | 242.05 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | [3,5-dichloro-4-(difluoromethoxy)phenyl]methanamine |
| SMILES | NCc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2F2NO/c9-5-1-4(3-13)2-6(10)7(5)14-8(11)12/h1-2,8H,3,13H2 |
| InChIKey | JJKXJBHBSCZJTR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.05 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |