C10H8Cl3F2NO2 — CID 54867408
3-chloro-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]propanamide (PubChem CID 54867408) has the molecular formula C10H8Cl3F2NO2 and a molecular weight of 318.53 g/mol. Its IUPAC name is 3-chloro-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]propanamide.
| Compound Name | 3-chloro-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 54867408 |
| Molecular Formula | C10H8Cl3F2NO2 |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 316.96 |
| IUPAC Name | 3-chloro-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]propanamide |
| SMILES | O=C(CCCl)Nc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl3F2NO2/c11-2-1-8(17)16-5-3-6(12)9(7(13)4-5)18-10(14)15/h3-4,10H,1-2H2,(H,16,17) |
| InChIKey | HUMOZUSWCPBOMJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|