C12H12Cl2F2N2O2 — CID 79285393
N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-2-(prop-2-enylamino)acetamide (PubChem CID 79285393) has the molecular formula C12H12Cl2F2N2O2 and a molecular weight of 325.14 g/mol. Its IUPAC name is N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-2-(prop-2-enylamino)acetamide.
| Compound Name | N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79285393 |
| Molecular Formula | C12H12Cl2F2N2O2 |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)Nc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2F2N2O2/c1-2-3-17-6-10(19)18-7-4-8(13)11(9(14)5-7)20-12(15)16/h2,4-5,12,17H,1,3,6H2,(H,18,19) |
| InChIKey | HMJQXJFAFMYILK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|