C11H13FN2O2 — CID 79278789
N-(3-fluoro-4-hydroxyphenyl)-2-(prop-2-enylamino)acetamide (PubChem CID 79278789) has the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. Its IUPAC name is N-(3-fluoro-4-hydroxyphenyl)-2-(prop-2-enylamino)acetamide.
| Compound Name | N-(3-fluoro-4-hydroxyphenyl)-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79278789 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-(3-fluoro-4-hydroxyphenyl)-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)Nc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C11H13FN2O2/c1-2-5-13-7-11(16)14-8-3-4-10(15)9(12)6-8/h2-4,6,13,15H,1,5,7H2,(H,14,16) |
| InChIKey | RWIGOABRHSCQKD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|