C11H12BrFN2O — CID 79279349
N-(4-bromo-3-fluorophenyl)-2-(prop-2-enylamino)acetamide (PubChem CID 79279349) has the molecular formula C11H12BrFN2O and a molecular weight of 287.13 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-2-(prop-2-enylamino)acetamide.
| Compound Name | N-(4-bromo-3-fluorophenyl)-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79279349 |
| Molecular Formula | C11H12BrFN2O |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C11H12BrFN2O/c1-2-5-14-7-11(16)15-8-3-4-9(12)10(13)6-8/h2-4,6,14H,1,5,7H2,(H,15,16) |
| InChIKey | HNJXFIFSIOKGRZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|