C13H14Cl2F2N2O2 — CID 60928604
N-[3,5-dichloro-4-(difluoromethoxy)phenyl]piperidine-4-carboxamide (PubChem CID 60928604) has the molecular formula C13H14Cl2F2N2O2 and a molecular weight of 339.17 g/mol. Its IUPAC name is N-[3,5-dichloro-4-(difluoromethoxy)phenyl]piperidine-4-carboxamide.
| Compound Name | N-[3,5-dichloro-4-(difluoromethoxy)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60928604 |
| Molecular Formula | C13H14Cl2F2N2O2 |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-[3,5-dichloro-4-(difluoromethoxy)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(OC(F)F)c(Cl)c1)C1CCNCC1 |
| InChI | InChI=1S/C13H14Cl2F2N2O2/c14-9-5-8(6-10(15)11(9)21-13(16)17)19-12(20)7-1-3-18-4-2-7/h5-7,13,18H,1-4H2,(H,19,20) |
| InChIKey | HDMFWVRFIQXUHU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |