C7H3Cl2F2IO — CID 118807817
1,4-dichloro-2-(difluoromethoxy)-3-iodobenzene (PubChem CID 118807817) has the molecular formula C7H3Cl2F2IO and a molecular weight of 338.91 g/mol. Its IUPAC name is 1,4-dichloro-2-(difluoromethoxy)-3-iodobenzene.
| Compound Name | 1,4-dichloro-2-(difluoromethoxy)-3-iodobenzene |
|---|---|
| PubChem CID | 118807817 |
| Molecular Formula | C7H3Cl2F2IO |
| Molecular Weight | 338.91 g/mol |
| Exact Mass | 337.86 |
| IUPAC Name | 1,4-dichloro-2-(difluoromethoxy)-3-iodobenzene |
| SMILES | FC(F)Oc1c(Cl)ccc(Cl)c1I |
| InChI | InChI=1S/C7H3Cl2F2IO/c8-3-1-2-4(9)6(5(3)12)13-7(10)11/h1-2,7H |
| InChIKey | XEIILGGUKZWOOW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.91 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|