About 2-(difluoromethoxy)-1,3-diiodobenzene
2-(difluoromethoxy)-1,3-diiodobenzene (PubChem CID 135741218) has the molecular formula C7H4F2I2O
and a molecular weight of 395.91 g/mol. Its IUPAC name is 2-(difluoromethoxy)-1,3-diiodobenzene.
Molecular Properties
| Compound Name | 2-(difluoromethoxy)-1,3-diiodobenzene |
| PubChem CID | 135741218 |
| Molecular Formula | C7H4F2I2O |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.83 |
| IUPAC Name | 2-(difluoromethoxy)-1,3-diiodobenzene |
| SMILES | FC(F)Oc1c(I)cccc1I |
| InChI | InChI=1S/C7H4F2I2O/c8-7(9)12-6-4(10)2-1-3-5(6)11/h1-3,7H |
| InChIKey | BCYRRGFUKPSUJQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethoxy)-1,3-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethoxy)-1,3-diiodobenzene?
The IUPAC name of 2-(difluoromethoxy)-1,3-diiodobenzene (CID 135741218) is 2-(difluoromethoxy)-1,3-diiodobenzene.
What is the SMILES notation for 2-(difluoromethoxy)-1,3-diiodobenzene?
The canonical SMILES for 2-(difluoromethoxy)-1,3-diiodobenzene is FC(F)Oc1c(I)cccc1I.
What is the InChIKey of 2-(difluoromethoxy)-1,3-diiodobenzene?
The InChIKey is BCYRRGFUKPSUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F2I2O/c8-7(9)12-6-4(10)2-1-3-5(6)11/h1-3,7H.
What are the key properties of 2-(difluoromethoxy)-1,3-diiodobenzene?
2-(difluoromethoxy)-1,3-diiodobenzene has a molecular weight of 395.91 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethoxy)-1,3-diiodobenzene is sourced from PubChem (CID 135741218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).