C12H8F4O2 — CID 166641341
1,5-bis(difluoromethoxy)naphthalene (PubChem CID 166641341) has the molecular formula C12H8F4O2 and a molecular weight of 260.19 g/mol. Its IUPAC name is 1,5-bis(difluoromethoxy)naphthalene.
| Compound Name | 1,5-bis(difluoromethoxy)naphthalene |
|---|---|
| PubChem CID | 166641341 |
| Molecular Formula | C12H8F4O2 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1,5-bis(difluoromethoxy)naphthalene |
| SMILES | FC(F)Oc1cccc2c(OC(F)F)cccc12 |
| InChI | InChI=1S/C12H8F4O2/c13-11(14)17-9-5-1-3-7-8(9)4-2-6-10(7)18-12(15)16/h1-6,11-12H |
| InChIKey | NQCNVVLAILSVFW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |