C13H12F2O — CID 56838953
1-(difluoromethoxy)-6,7-dimethylnaphthalene (PubChem CID 56838953) has the molecular formula C13H12F2O and a molecular weight of 222.23 g/mol. Its IUPAC name is 1-(difluoromethoxy)-6,7-dimethylnaphthalene.
| Compound Name | 1-(difluoromethoxy)-6,7-dimethylnaphthalene |
|---|---|
| PubChem CID | 56838953 |
| Molecular Formula | C13H12F2O |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-(difluoromethoxy)-6,7-dimethylnaphthalene |
| SMILES | Cc1cc2cccc(OC(F)F)c2cc1C |
| InChI | InChI=1S/C13H12F2O/c1-8-6-10-4-3-5-12(16-13(14)15)11(10)7-9(8)2/h3-7,13H,1-2H3 |
| InChIKey | CQDOWGGJRJHCCG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |