C11H14F4O2 — CID 145191188
1,3-bis(difluoromethoxy)-2-methylbenzene;ethane (PubChem CID 145191188) has the molecular formula C11H14F4O2 and a molecular weight of 254.22 g/mol. Its IUPAC name is 1,3-bis(difluoromethoxy)-2-methylbenzene;ethane.
| Compound Name | 1,3-bis(difluoromethoxy)-2-methylbenzene;ethane |
|---|---|
| PubChem CID | 145191188 |
| Molecular Formula | C11H14F4O2 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1,3-bis(difluoromethoxy)-2-methylbenzene;ethane |
| SMILES | CC.Cc1c(OC(F)F)cccc1OC(F)F |
| InChI | InChI=1S/C9H8F4O2.C2H6/c1-5-6(14-8(10)11)3-2-4-7(5)15-9(12)13;1-2/h2-4,8-9H,1H3;1-2H3 |
| InChIKey | BUZDPTWUJKISNC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |