C15H14F2O — CID 151061360
2-[2-(difluoromethoxy)phenyl]-1,3-dimethylbenzene (PubChem CID 151061360) has the molecular formula C15H14F2O and a molecular weight of 248.27 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)phenyl]-1,3-dimethylbenzene.
| Compound Name | 2-[2-(difluoromethoxy)phenyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 151061360 |
| Molecular Formula | C15H14F2O |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[2-(difluoromethoxy)phenyl]-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1-c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H14F2O/c1-10-6-5-7-11(2)14(10)12-8-3-4-9-13(12)18-15(16)17/h3-9,15H,1-2H3 |
| InChIKey | MGFQJHZZDBAXNB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |