C16H21N — CID 13202805
1-(6,7-dimethylnaphthalen-1-yl)-2-methylpropan-1-amine (PubChem CID 13202805) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-(6,7-dimethylnaphthalen-1-yl)-2-methylpropan-1-amine.
| Compound Name | 1-(6,7-dimethylnaphthalen-1-yl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 13202805 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 1-(6,7-dimethylnaphthalen-1-yl)-2-methylpropan-1-amine |
| SMILES | Cc1cc2cccc(C(N)C(C)C)c2cc1C |
| InChI | InChI=1S/C16H21N/c1-10(2)16(17)14-7-5-6-13-8-11(3)12(4)9-15(13)14/h5-10,16H,17H2,1-4H3 |
| InChIKey | FUVIOSNVJXXNCG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |