C8H8F4N2O2 — CID 118841228
[2,3-bis(difluoromethoxy)phenyl]hydrazine (PubChem CID 118841228) has the molecular formula C8H8F4N2O2 and a molecular weight of 240.16 g/mol. Its IUPAC name is [2,3-bis(difluoromethoxy)phenyl]hydrazine.
| Compound Name | [2,3-bis(difluoromethoxy)phenyl]hydrazine |
|---|---|
| PubChem CID | 118841228 |
| Molecular Formula | C8H8F4N2O2 |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [2,3-bis(difluoromethoxy)phenyl]hydrazine |
| SMILES | NNc1cccc(OC(F)F)c1OC(F)F |
| InChI | InChI=1S/C8H8F4N2O2/c9-7(10)15-5-3-1-2-4(14-13)6(5)16-8(11)12/h1-3,7-8,14H,13H2 |
| InChIKey | XJBJOTQXKDYCHB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|