C9H9F2IO3 — CID 118819202
2-(difluoromethoxy)-3-iodo-1,4-dimethoxybenzene (PubChem CID 118819202) has the molecular formula C9H9F2IO3 and a molecular weight of 330.07 g/mol. Its IUPAC name is 2-(difluoromethoxy)-3-iodo-1,4-dimethoxybenzene.
| Compound Name | 2-(difluoromethoxy)-3-iodo-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 118819202 |
| Molecular Formula | C9H9F2IO3 |
| Molecular Weight | 330.07 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 2-(difluoromethoxy)-3-iodo-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(OC(F)F)c1I |
| InChI | InChI=1S/C9H9F2IO3/c1-13-5-3-4-6(14-2)8(7(5)12)15-9(10)11/h3-4,9H,1-2H3 |
| InChIKey | SEIRAZZZBJNBKI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.07 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|