C8H8I2O — CID 130056548
2,3-diiodo-1-methoxy-4-methylbenzene (PubChem CID 130056548) has the molecular formula C8H8I2O and a molecular weight of 373.96 g/mol. Its IUPAC name is 2,3-diiodo-1-methoxy-4-methylbenzene.
| Compound Name | 2,3-diiodo-1-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 130056548 |
| Molecular Formula | C8H8I2O |
| Molecular Weight | 373.96 g/mol |
| Exact Mass | 373.87 |
| IUPAC Name | 2,3-diiodo-1-methoxy-4-methylbenzene |
| SMILES | COc1ccc(C)c(I)c1I |
| InChI | InChI=1S/C8H8I2O/c1-5-3-4-6(11-2)8(10)7(5)9/h3-4H,1-2H3 |
| InChIKey | SYJPPNIBWYWHAL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.96 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|