C10H13IO2 — CID 171397463
3-iodo-1-(methoxymethoxy)-2,4-dimethylbenzene (PubChem CID 171397463) has the molecular formula C10H13IO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is 3-iodo-1-(methoxymethoxy)-2,4-dimethylbenzene.
| Compound Name | 3-iodo-1-(methoxymethoxy)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 171397463 |
| Molecular Formula | C10H13IO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 3-iodo-1-(methoxymethoxy)-2,4-dimethylbenzene |
| SMILES | COCOc1ccc(C)c(I)c1C |
| InChI | InChI=1S/C10H13IO2/c1-7-4-5-9(13-6-12-3)8(2)10(7)11/h4-5H,6H2,1-3H3 |
| InChIKey | GCKJVOKPROCQLT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|