C30H34Br2O8 — CID 158698772
2,6-bis(methoxymethoxy)-1,5-dimethylnaphthalene;1,5-dibromo-2,6-bis(methoxymethoxy)naphthalene (PubChem CID 158698772) has the molecular formula C30H34Br2O8 and a molecular weight of 682.40 g/mol. Its IUPAC name is 2,6-bis(methoxymethoxy)-1,5-dimethylnaphthalene;1,5-dibromo-2,6-bis(methoxymethoxy)naphthalene.
| Compound Name | 2,6-bis(methoxymethoxy)-1,5-dimethylnaphthalene;1,5-dibromo-2,6-bis(methoxymethoxy)naphthalene |
|---|---|
| PubChem CID | 158698772 |
| Molecular Formula | C30H34Br2O8 |
| Molecular Weight | 682.40 g/mol |
| Exact Mass | 680.06 |
| IUPAC Name | 2,6-bis(methoxymethoxy)-1,5-dimethylnaphthalene;1,5-dibromo-2,6-bis(methoxymethoxy)naphthalene |
| SMILES | COCOc1ccc2c(Br)c(OCOC)ccc2c1Br.COCOc1ccc2c(C)c(OCOC)ccc2c1C |
| InChI | InChI=1S/C16H20O4.C14H14Br2O4/c1-11-13-5-8-16(20-10-18-4)12(2)14(13)6-7-15(11)19-9-17-3;1-17-7-19-11-5-3-10-9(13(11)15)4-6-12(14(10)16)20-8-18-2/h5-8H,9-10H2,1-4H3;3-6H,7-8H2,1-2H3 |
| InChIKey | IHGQEOHZOCLPBG-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.40 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|