About 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol
2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol (PubChem CID 167679834) has the molecular formula C14H12Br2F2O3
and a molecular weight of 426.05 g/mol. Its IUPAC name is 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol.
Molecular Properties
| Compound Name | 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol |
| PubChem CID | 167679834 |
| Molecular Formula | C14H12Br2F2O3 |
| Molecular Weight | 426.05 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol |
| SMILES | COCOc1cccc(F)c1Br.Oc1cccc(F)c1Br |
| InChI | InChI=1S/C8H8BrFO2.C6H4BrFO/c1-11-5-12-7-4-2-3-6(10)8(7)9;7-6-4(8)2-1-3-5(6)9/h2-4H,5H2,1H3;1-3,9H |
| InChIKey | VJASNDCSMYZYHK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.05 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol?
The IUPAC name of 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol (CID 167679834) is 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol.
What is the SMILES notation for 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol?
The canonical SMILES for 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol is COCOc1cccc(F)c1Br.Oc1cccc(F)c1Br.
What is the InChIKey of 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol?
The InChIKey is VJASNDCSMYZYHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrFO2.C6H4BrFO/c1-11-5-12-7-4-2-3-6(10)8(7)9;7-6-4(8)2-1-3-5(6)9/h2-4H,5H2,1H3;1-3,9H.
What are the key properties of 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol?
2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol has a molecular weight of 426.05 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-fluoro-3-(methoxymethoxy)benzene;2-bromo-3-fluorophenol is sourced from PubChem (CID 167679834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).