C18H26Br2O6 — CID 161492235
2-bromobenzene-1,3-diol;2-bromo-1,3-bis(methoxymethoxy)benzene;methane (PubChem CID 161492235) has the molecular formula C18H26Br2O6 and a molecular weight of 498.21 g/mol. Its IUPAC name is 2-bromobenzene-1,3-diol;2-bromo-1,3-bis(methoxymethoxy)benzene;methane.
| Compound Name | 2-bromobenzene-1,3-diol;2-bromo-1,3-bis(methoxymethoxy)benzene;methane |
|---|---|
| PubChem CID | 161492235 |
| Molecular Formula | C18H26Br2O6 |
| Molecular Weight | 498.21 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 2-bromobenzene-1,3-diol;2-bromo-1,3-bis(methoxymethoxy)benzene;methane |
| SMILES | C.C.COCOc1cccc(OCOC)c1Br.Oc1cccc(O)c1Br |
| InChI | InChI=1S/C10H13BrO4.C6H5BrO2.2CH4/c1-12-6-14-8-4-3-5-9(10(8)11)15-7-13-2;7-6-4(8)2-1-3-5(6)9;;/h3-5H,6-7H2,1-2H3;1-3,8-9H;2*1H4 |
| InChIKey | WFTMTLQFOBDUAS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.21 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|