C11H14O3 — CID 130651927
(1S)-7-(methoxymethoxy)-2,3-dihydro-1H-inden-1-ol (PubChem CID 130651927) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (1S)-7-(methoxymethoxy)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1S)-7-(methoxymethoxy)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 130651927 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (1S)-7-(methoxymethoxy)-2,3-dihydro-1H-inden-1-ol |
| SMILES | COCOc1cccc2c1[C@@H](O)CC2 |
| InChI | InChI=1S/C11H14O3/c1-13-7-14-10-4-2-3-8-5-6-9(12)11(8)10/h2-4,9,12H,5-7H2,1H3/t9-/m0/s1 |
| InChIKey | BPNXXGPEJQIVQU-VIFPVBQESA-N |
| XLogP | 1.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|