C18H24O3 — CID 10356773
(5R,6R)-6-[2-(methoxymethoxy)phenyl]-2-methyl-5-prop-1-en-2-ylcyclohexen-1-ol (PubChem CID 10356773) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (5R,6R)-6-[2-(methoxymethoxy)phenyl]-2-methyl-5-prop-1-en-2-ylcyclohexen-1-ol.
| Compound Name | (5R,6R)-6-[2-(methoxymethoxy)phenyl]-2-methyl-5-prop-1-en-2-ylcyclohexen-1-ol |
|---|---|
| PubChem CID | 10356773 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (5R,6R)-6-[2-(methoxymethoxy)phenyl]-2-methyl-5-prop-1-en-2-ylcyclohexen-1-ol |
| SMILES | C=C(C)[C@@H]1CCC(C)=C(O)[C@H]1c1ccccc1OCOC |
| InChI | InChI=1S/C18H24O3/c1-12(2)14-10-9-13(3)18(19)17(14)15-7-5-6-8-16(15)21-11-20-4/h5-8,14,17,19H,1,9-11H2,2-4H3/t14-,17+/m0/s1 |
| InChIKey | VUCLFAVFALZJIV-WMLDXEAASA-N |
| XLogP | 4.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|