C20H30O4 — CID 57005677
[(1S,2R)-2-[2-(methoxymethoxy)phenyl]cyclohexyl] hexanoate (PubChem CID 57005677) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is [(1S,2R)-2-[2-(methoxymethoxy)phenyl]cyclohexyl] hexanoate.
| Compound Name | [(1S,2R)-2-[2-(methoxymethoxy)phenyl]cyclohexyl] hexanoate |
|---|---|
| PubChem CID | 57005677 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [(1S,2R)-2-[2-(methoxymethoxy)phenyl]cyclohexyl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1CCCC[C@@H]1c1ccccc1OCOC |
| InChI | InChI=1S/C20H30O4/c1-3-4-5-14-20(21)24-19-13-9-7-11-17(19)16-10-6-8-12-18(16)23-15-22-2/h6,8,10,12,17,19H,3-5,7,9,11,13-15H2,1-2H3/t17-,19+/m1/s1 |
| InChIKey | CZKYONVRGZBWRG-MJGOQNOKSA-N |
| XLogP | 4.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|